C21H21NO3S — CID 25041291
N-(2,2-diphenylethyl)-4-methoxybenzenesulfonamide (PubChem CID 25041291) has the molecular formula C21H21NO3S and a molecular weight of 367.47 g/mol. Its IUPAC name is N-(2,2-diphenylethyl)-4-methoxybenzenesulfonamide.
| Compound Name | N-(2,2-diphenylethyl)-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 25041291 |
| Molecular Formula | C21H21NO3S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | N-(2,2-diphenylethyl)-4-methoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NCC(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H21NO3S/c1-25-19-12-14-20(15-13-19)26(23,24)22-16-21(17-8-4-2-5-9-17)18-10-6-3-7-11-18/h2-15,21-22H,16H2,1H3 |
| InChIKey | YVDVQBFOTDPHCE-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |