C16H19NO5S — CID 6930429
N-[(2R)-2-hydroxy-3-(4-methoxyphenoxy)propyl]benzenesulfonamide (PubChem CID 6930429) has the molecular formula C16H19NO5S and a molecular weight of 337.40 g/mol. Its IUPAC name is N-[(2R)-2-hydroxy-3-(4-methoxyphenoxy)propyl]benzenesulfonamide.
| Compound Name | N-[(2R)-2-hydroxy-3-(4-methoxyphenoxy)propyl]benzenesulfonamide |
|---|---|
| PubChem CID | 6930429 |
| Molecular Formula | C16H19NO5S |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | N-[(2R)-2-hydroxy-3-(4-methoxyphenoxy)propyl]benzenesulfonamide |
| SMILES | COc1ccc(OC[C@H](O)CNS(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C16H19NO5S/c1-21-14-7-9-15(10-8-14)22-12-13(18)11-17-23(19,20)16-5-3-2-4-6-16/h2-10,13,17-18H,11-12H2,1H3/t13-/m1/s1 |
| InChIKey | KUKKRTHRYYMLKR-CYBMUJFWSA-N |
| XLogP | 1.41 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |