C13H22N2O5S — CID 60909902
N-[2-[[2-hydroxy-3-(4-methoxyphenoxy)propyl]amino]ethyl]methanesulfonamide (PubChem CID 60909902) has the molecular formula C13H22N2O5S and a molecular weight of 318.39 g/mol. Its IUPAC name is N-[2-[[2-hydroxy-3-(4-methoxyphenoxy)propyl]amino]ethyl]methanesulfonamide.
| Compound Name | N-[2-[[2-hydroxy-3-(4-methoxyphenoxy)propyl]amino]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 60909902 |
| Molecular Formula | C13H22N2O5S |
| Molecular Weight | 318.39 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | N-[2-[[2-hydroxy-3-(4-methoxyphenoxy)propyl]amino]ethyl]methanesulfonamide |
| SMILES | COc1ccc(OCC(O)CNCCNS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C13H22N2O5S/c1-19-12-3-5-13(6-4-12)20-10-11(16)9-14-7-8-15-21(2,17)18/h3-6,11,14-16H,7-10H2,1-2H3 |
| InChIKey | DZZSBRYSSRCCRJ-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.39 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|