C14H17NO5S2 — CID 6930511
N-[(2S)-2-hydroxy-3-(4-methoxyphenoxy)propyl]thiophene-2-sulfonamide (PubChem CID 6930511) has the molecular formula C14H17NO5S2 and a molecular weight of 343.43 g/mol. Its IUPAC name is N-[(2S)-2-hydroxy-3-(4-methoxyphenoxy)propyl]thiophene-2-sulfonamide.
| Compound Name | N-[(2S)-2-hydroxy-3-(4-methoxyphenoxy)propyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 6930511 |
| Molecular Formula | C14H17NO5S2 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.05 |
| IUPAC Name | N-[(2S)-2-hydroxy-3-(4-methoxyphenoxy)propyl]thiophene-2-sulfonamide |
| SMILES | COc1ccc(OC[C@@H](O)CNS(=O)(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C14H17NO5S2/c1-19-12-4-6-13(7-5-12)20-10-11(16)9-15-22(17,18)14-3-2-8-21-14/h2-8,11,15-16H,9-10H2,1H3/t11-/m0/s1 |
| InChIKey | WOYJFLCQTWDXKT-NSHDSACASA-N |
| XLogP | 1.47 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |