C19H20N2O5S2 — CID 2812612
N-[2-hydroxy-3-(4-methoxyphenoxy)propyl]-5-pyridin-2-ylthiophene-2-sulfonamide (PubChem CID 2812612) has the molecular formula C19H20N2O5S2 and a molecular weight of 420.51 g/mol. Its IUPAC name is N-[2-hydroxy-3-(4-methoxyphenoxy)propyl]-5-pyridin-2-ylthiophene-2-sulfonamide.
| Compound Name | N-[2-hydroxy-3-(4-methoxyphenoxy)propyl]-5-pyridin-2-ylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 2812612 |
| Molecular Formula | C19H20N2O5S2 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.08 |
| IUPAC Name | N-[2-hydroxy-3-(4-methoxyphenoxy)propyl]-5-pyridin-2-ylthiophene-2-sulfonamide |
| SMILES | COc1ccc(OCC(O)CNS(=O)(=O)c2ccc(-c3ccccn3)s2)cc1 |
| InChI | InChI=1S/C19H20N2O5S2/c1-25-15-5-7-16(8-6-15)26-13-14(22)12-21-28(23,24)19-10-9-18(27-19)17-4-2-3-11-20-17/h2-11,14,21-22H,12-13H2,1H3 |
| InChIKey | WZNJEKBSJALXQK-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 97.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |