C7H9NO5S2 — CID 66168152
2-hydroxy-3-(thiophen-2-ylsulfonylamino)propanoic acid (PubChem CID 66168152) has the molecular formula C7H9NO5S2 and a molecular weight of 251.28 g/mol. Its IUPAC name is 2-hydroxy-3-(thiophen-2-ylsulfonylamino)propanoic acid.
| Compound Name | 2-hydroxy-3-(thiophen-2-ylsulfonylamino)propanoic acid |
|---|---|
| PubChem CID | 66168152 |
| Molecular Formula | C7H9NO5S2 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 250.99 |
| IUPAC Name | 2-hydroxy-3-(thiophen-2-ylsulfonylamino)propanoic acid |
| SMILES | O=C(O)C(O)CNS(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C7H9NO5S2/c9-5(7(10)11)4-8-15(12,13)6-2-1-3-14-6/h1-3,5,8-9H,4H2,(H,10,11) |
| InChIKey | BKYJBNADCDJWII-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |