C18H17NO2S2 — CID 4994922
N-(2,2-diphenylethyl)thiophene-2-sulfonamide (PubChem CID 4994922) has the molecular formula C18H17NO2S2 and a molecular weight of 343.47 g/mol. Its IUPAC name is N-(2,2-diphenylethyl)thiophene-2-sulfonamide.
| Compound Name | N-(2,2-diphenylethyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 4994922 |
| Molecular Formula | C18H17NO2S2 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | N-(2,2-diphenylethyl)thiophene-2-sulfonamide |
| SMILES | O=S(=O)(NCC(c1ccccc1)c1ccccc1)c1cccs1 |
| InChI | InChI=1S/C18H17NO2S2/c20-23(21,18-12-7-13-22-18)19-14-17(15-8-3-1-4-9-15)16-10-5-2-6-11-16/h1-13,17,19H,14H2 |
| InChIKey | OSZBSANLBKNMSW-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |