C18H16ClNO4S3 — CID 51662811
2-chloro-N-[(2R)-2-phenyl-2-thiophen-2-ylsulfonylethyl]benzenesulfonamide (PubChem CID 51662811) has the molecular formula C18H16ClNO4S3 and a molecular weight of 441.98 g/mol. Its IUPAC name is 2-chloro-N-[(2R)-2-phenyl-2-thiophen-2-ylsulfonylethyl]benzenesulfonamide.
| Compound Name | 2-chloro-N-[(2R)-2-phenyl-2-thiophen-2-ylsulfonylethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 51662811 |
| Molecular Formula | C18H16ClNO4S3 |
| Molecular Weight | 441.98 g/mol |
| Exact Mass | 440.99 |
| IUPAC Name | 2-chloro-N-[(2R)-2-phenyl-2-thiophen-2-ylsulfonylethyl]benzenesulfonamide |
| SMILES | O=S(=O)(NC[C@@H](c1ccccc1)S(=O)(=O)c1cccs1)c1ccccc1Cl |
| InChI | InChI=1S/C18H16ClNO4S3/c19-15-9-4-5-10-16(15)27(23,24)20-13-17(14-7-2-1-3-8-14)26(21,22)18-11-6-12-25-18/h1-12,17,20H,13H2/t17-/m0/s1 |
| InChIKey | RETIAWOUEUODNZ-KRWDZBQOSA-N |
| XLogP | 3.89 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.98 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |