C9H10ClNO5S — CID 104935868
(2S)-3-[(2-chlorophenyl)sulfonylamino]-2-hydroxypropanoic acid (PubChem CID 104935868) has the molecular formula C9H10ClNO5S and a molecular weight of 279.70 g/mol. Its IUPAC name is (2S)-3-[(2-chlorophenyl)sulfonylamino]-2-hydroxypropanoic acid.
| Compound Name | (2S)-3-[(2-chlorophenyl)sulfonylamino]-2-hydroxypropanoic acid |
|---|---|
| PubChem CID | 104935868 |
| Molecular Formula | C9H10ClNO5S |
| Molecular Weight | 279.70 g/mol |
| Exact Mass | 279.00 |
| IUPAC Name | (2S)-3-[(2-chlorophenyl)sulfonylamino]-2-hydroxypropanoic acid |
| SMILES | O=C(O)[C@@H](O)CNS(=O)(=O)c1ccccc1Cl |
| InChI | InChI=1S/C9H10ClNO5S/c10-6-3-1-2-4-8(6)17(15,16)11-5-7(12)9(13)14/h1-4,7,11-12H,5H2,(H,13,14)/t7-/m0/s1 |
| InChIKey | VATKSLITPMTVSS-ZETCQYMHSA-N |
| XLogP | 0.06 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.70 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |