C11H13Cl2NO4S — CID 65222532
2-[[(2,3-dichlorophenyl)sulfonylamino]methyl]butanoic acid (PubChem CID 65222532) has the molecular formula C11H13Cl2NO4S and a molecular weight of 326.20 g/mol. Its IUPAC name is 2-[[(2,3-dichlorophenyl)sulfonylamino]methyl]butanoic acid.
| Compound Name | 2-[[(2,3-dichlorophenyl)sulfonylamino]methyl]butanoic acid |
|---|---|
| PubChem CID | 65222532 |
| Molecular Formula | C11H13Cl2NO4S |
| Molecular Weight | 326.20 g/mol |
| Exact Mass | 324.99 |
| IUPAC Name | 2-[[(2,3-dichlorophenyl)sulfonylamino]methyl]butanoic acid |
| SMILES | CCC(CNS(=O)(=O)c1cccc(Cl)c1Cl)C(=O)O |
| InChI | InChI=1S/C11H13Cl2NO4S/c1-2-7(11(15)16)6-14-19(17,18)9-5-3-4-8(12)10(9)13/h3-5,7,14H,2,6H2,1H3,(H,15,16) |
| InChIKey | XDSHHLOJICLQNT-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.20 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |