C9H10Cl2N2O3S — CID 8505483
N'-(2,3-dichlorophenyl)sulfonylpropanehydrazide (PubChem CID 8505483) has the molecular formula C9H10Cl2N2O3S and a molecular weight of 297.16 g/mol. Its IUPAC name is N'-(2,3-dichlorophenyl)sulfonylpropanehydrazide.
| Compound Name | N'-(2,3-dichlorophenyl)sulfonylpropanehydrazide |
|---|---|
| PubChem CID | 8505483 |
| Molecular Formula | C9H10Cl2N2O3S |
| Molecular Weight | 297.16 g/mol |
| Exact Mass | 295.98 |
| IUPAC Name | N'-(2,3-dichlorophenyl)sulfonylpropanehydrazide |
| SMILES | CCC(=O)NNS(=O)(=O)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C9H10Cl2N2O3S/c1-2-8(14)12-13-17(15,16)7-5-3-4-6(10)9(7)11/h3-5,13H,2H2,1H3,(H,12,14) |
| InChIKey | VALVJPMYQGACLF-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.16 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|