C9H10ClFN2O3S — CID 8505477
N'-(3-chloro-4-fluorophenyl)sulfonylpropanehydrazide (PubChem CID 8505477) has the molecular formula C9H10ClFN2O3S and a molecular weight of 280.71 g/mol. Its IUPAC name is N'-(3-chloro-4-fluorophenyl)sulfonylpropanehydrazide.
| Compound Name | N'-(3-chloro-4-fluorophenyl)sulfonylpropanehydrazide |
|---|---|
| PubChem CID | 8505477 |
| Molecular Formula | C9H10ClFN2O3S |
| Molecular Weight | 280.71 g/mol |
| Exact Mass | 280.01 |
| IUPAC Name | N'-(3-chloro-4-fluorophenyl)sulfonylpropanehydrazide |
| SMILES | CCC(=O)NNS(=O)(=O)c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C9H10ClFN2O3S/c1-2-9(14)12-13-17(15,16)6-3-4-8(11)7(10)5-6/h3-5,13H,2H2,1H3,(H,12,14) |
| InChIKey | HLDNPLRXNFTLOD-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.71 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|