C8H7ClFNO4S — CID 697755
2-[(3-chloro-4-fluorophenyl)sulfonylamino]acetic acid (PubChem CID 697755) has the molecular formula C8H7ClFNO4S and a molecular weight of 267.67 g/mol. Its IUPAC name is 2-[(3-chloro-4-fluorophenyl)sulfonylamino]acetic acid.
| Compound Name | 2-[(3-chloro-4-fluorophenyl)sulfonylamino]acetic acid |
|---|---|
| PubChem CID | 697755 |
| Molecular Formula | C8H7ClFNO4S |
| Molecular Weight | 267.67 g/mol |
| Exact Mass | 266.98 |
| IUPAC Name | 2-[(3-chloro-4-fluorophenyl)sulfonylamino]acetic acid |
| SMILES | O=C(O)CNS(=O)(=O)c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C8H7ClFNO4S/c9-6-3-5(1-2-7(6)10)16(14,15)11-4-8(12)13/h1-3,11H,4H2,(H,12,13) |
| InChIKey | RCRPLYVUYSMZDL-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.67 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |