C14H11ClF2N2O3S — CID 52813347
2-[(3-chloro-4-fluorophenyl)sulfonylamino]-N-(3-fluorophenyl)acetamide (PubChem CID 52813347) has the molecular formula C14H11ClF2N2O3S and a molecular weight of 360.77 g/mol. Its IUPAC name is 2-[(3-chloro-4-fluorophenyl)sulfonylamino]-N-(3-fluorophenyl)acetamide.
| Compound Name | 2-[(3-chloro-4-fluorophenyl)sulfonylamino]-N-(3-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 52813347 |
| Molecular Formula | C14H11ClF2N2O3S |
| Molecular Weight | 360.77 g/mol |
| Exact Mass | 360.01 |
| IUPAC Name | 2-[(3-chloro-4-fluorophenyl)sulfonylamino]-N-(3-fluorophenyl)acetamide |
| SMILES | O=C(CNS(=O)(=O)c1ccc(F)c(Cl)c1)Nc1cccc(F)c1 |
| InChI | InChI=1S/C14H11ClF2N2O3S/c15-12-7-11(4-5-13(12)17)23(21,22)18-8-14(20)19-10-3-1-2-9(16)6-10/h1-7,18H,8H2,(H,19,20) |
| InChIKey | SWDBNPQTPNWYSI-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.77 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |