C12H11FN2O3S2 — CID 4615673
N-(3-fluorophenyl)-2-(thiophen-2-ylsulfonylamino)acetamide (PubChem CID 4615673) has the molecular formula C12H11FN2O3S2 and a molecular weight of 314.36 g/mol. Its IUPAC name is N-(3-fluorophenyl)-2-(thiophen-2-ylsulfonylamino)acetamide.
| Compound Name | N-(3-fluorophenyl)-2-(thiophen-2-ylsulfonylamino)acetamide |
|---|---|
| PubChem CID | 4615673 |
| Molecular Formula | C12H11FN2O3S2 |
| Molecular Weight | 314.36 g/mol |
| Exact Mass | 314.02 |
| IUPAC Name | N-(3-fluorophenyl)-2-(thiophen-2-ylsulfonylamino)acetamide |
| SMILES | O=C(CNS(=O)(=O)c1cccs1)Nc1cccc(F)c1 |
| InChI | InChI=1S/C12H11FN2O3S2/c13-9-3-1-4-10(7-9)15-11(16)8-14-20(17,18)12-5-2-6-19-12/h1-7,14H,8H2,(H,15,16) |
| InChIKey | VYJZDCHUXGAIHS-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.36 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |