C13H14N2O3S3 — CID 4615674
N-(3-methylsulfanylphenyl)-2-(thiophen-2-ylsulfonylamino)acetamide (PubChem CID 4615674) has the molecular formula C13H14N2O3S3 and a molecular weight of 342.47 g/mol. Its IUPAC name is N-(3-methylsulfanylphenyl)-2-(thiophen-2-ylsulfonylamino)acetamide.
| Compound Name | N-(3-methylsulfanylphenyl)-2-(thiophen-2-ylsulfonylamino)acetamide |
|---|---|
| PubChem CID | 4615674 |
| Molecular Formula | C13H14N2O3S3 |
| Molecular Weight | 342.47 g/mol |
| Exact Mass | 342.02 |
| IUPAC Name | N-(3-methylsulfanylphenyl)-2-(thiophen-2-ylsulfonylamino)acetamide |
| SMILES | CSc1cccc(NC(=O)CNS(=O)(=O)c2cccs2)c1 |
| InChI | InChI=1S/C13H14N2O3S3/c1-19-11-5-2-4-10(8-11)15-12(16)9-14-21(17,18)13-6-3-7-20-13/h2-8,14H,9H2,1H3,(H,15,16) |
| InChIKey | VMRJERHNCWULMU-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.47 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |