C19H17FN2O3S3 — CID 30266955
2-(2-fluoro-N-thiophen-2-ylsulfonylanilino)-N-(3-methylsulfanylphenyl)acetamide (PubChem CID 30266955) has the molecular formula C19H17FN2O3S3 and a molecular weight of 436.56 g/mol. Its IUPAC name is 2-(2-fluoro-N-thiophen-2-ylsulfonylanilino)-N-(3-methylsulfanylphenyl)acetamide.
| Compound Name | 2-(2-fluoro-N-thiophen-2-ylsulfonylanilino)-N-(3-methylsulfanylphenyl)acetamide |
|---|---|
| PubChem CID | 30266955 |
| Molecular Formula | C19H17FN2O3S3 |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.04 |
| IUPAC Name | 2-(2-fluoro-N-thiophen-2-ylsulfonylanilino)-N-(3-methylsulfanylphenyl)acetamide |
| SMILES | CSc1cccc(NC(=O)CN(c2ccccc2F)S(=O)(=O)c2cccs2)c1 |
| InChI | InChI=1S/C19H17FN2O3S3/c1-26-15-7-4-6-14(12-15)21-18(23)13-22(17-9-3-2-8-16(17)20)28(24,25)19-10-5-11-27-19/h2-12H,13H2,1H3,(H,21,23) |
| InChIKey | XKDXEZLYHAQOCQ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |