C12H11FN2O3S2 — CID 30255117
2-(2-fluoro-N-thiophen-2-ylsulfonylanilino)acetamide (PubChem CID 30255117) has the molecular formula C12H11FN2O3S2 and a molecular weight of 314.36 g/mol. Its IUPAC name is 2-(2-fluoro-N-thiophen-2-ylsulfonylanilino)acetamide.
| Compound Name | 2-(2-fluoro-N-thiophen-2-ylsulfonylanilino)acetamide |
|---|---|
| PubChem CID | 30255117 |
| Molecular Formula | C12H11FN2O3S2 |
| Molecular Weight | 314.36 g/mol |
| Exact Mass | 314.02 |
| IUPAC Name | 2-(2-fluoro-N-thiophen-2-ylsulfonylanilino)acetamide |
| SMILES | NC(=O)CN(c1ccccc1F)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C12H11FN2O3S2/c13-9-4-1-2-5-10(9)15(8-11(14)16)20(17,18)12-6-3-7-19-12/h1-7H,8H2,(H2,14,16) |
| InChIKey | GFURKICIPMXHMM-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.36 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |