C17H22FN3O3S2 — CID 30271855
N-[3-(dimethylamino)propyl]-2-(2-fluoro-N-thiophen-2-ylsulfonylanilino)acetamide (PubChem CID 30271855) has the molecular formula C17H22FN3O3S2 and a molecular weight of 399.51 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-2-(2-fluoro-N-thiophen-2-ylsulfonylanilino)acetamide.
| Compound Name | N-[3-(dimethylamino)propyl]-2-(2-fluoro-N-thiophen-2-ylsulfonylanilino)acetamide |
|---|---|
| PubChem CID | 30271855 |
| Molecular Formula | C17H22FN3O3S2 |
| Molecular Weight | 399.51 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-2-(2-fluoro-N-thiophen-2-ylsulfonylanilino)acetamide |
| SMILES | CN(C)CCCNC(=O)CN(c1ccccc1F)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C17H22FN3O3S2/c1-20(2)11-6-10-19-16(22)13-21(15-8-4-3-7-14(15)18)26(23,24)17-9-5-12-25-17/h3-5,7-9,12H,6,10-11,13H2,1-2H3,(H,19,22) |
| InChIKey | MXAVEWIQMUWHDI-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.51 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|