C18H16FN3O3S2 — CID 30265451
2-(2-fluoro-N-thiophen-2-ylsulfonylanilino)-N-(pyridin-2-ylmethyl)acetamide (PubChem CID 30265451) has the molecular formula C18H16FN3O3S2 and a molecular weight of 405.48 g/mol. Its IUPAC name is 2-(2-fluoro-N-thiophen-2-ylsulfonylanilino)-N-(pyridin-2-ylmethyl)acetamide.
| Compound Name | 2-(2-fluoro-N-thiophen-2-ylsulfonylanilino)-N-(pyridin-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 30265451 |
| Molecular Formula | C18H16FN3O3S2 |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.06 |
| IUPAC Name | 2-(2-fluoro-N-thiophen-2-ylsulfonylanilino)-N-(pyridin-2-ylmethyl)acetamide |
| SMILES | O=C(CN(c1ccccc1F)S(=O)(=O)c1cccs1)NCc1ccccn1 |
| InChI | InChI=1S/C18H16FN3O3S2/c19-15-7-1-2-8-16(15)22(27(24,25)18-9-5-11-26-18)13-17(23)21-12-14-6-3-4-10-20-14/h1-11H,12-13H2,(H,21,23) |
| InChIKey | AYGMQZCRZGGEAE-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |