C23H25FN2O3S2 — CID 43901298
N-(2-benzylbutyl)-2-(2-fluoro-N-thiophen-2-ylsulfonylanilino)acetamide (PubChem CID 43901298) has the molecular formula C23H25FN2O3S2 and a molecular weight of 460.60 g/mol. Its IUPAC name is N-(2-benzylbutyl)-2-(2-fluoro-N-thiophen-2-ylsulfonylanilino)acetamide.
| Compound Name | N-(2-benzylbutyl)-2-(2-fluoro-N-thiophen-2-ylsulfonylanilino)acetamide |
|---|---|
| PubChem CID | 43901298 |
| Molecular Formula | C23H25FN2O3S2 |
| Molecular Weight | 460.60 g/mol |
| Exact Mass | 460.13 |
| IUPAC Name | N-(2-benzylbutyl)-2-(2-fluoro-N-thiophen-2-ylsulfonylanilino)acetamide |
| SMILES | CCC(CNC(=O)CN(c1ccccc1F)S(=O)(=O)c1cccs1)Cc1ccccc1 |
| InChI | InChI=1S/C23H25FN2O3S2/c1-2-18(15-19-9-4-3-5-10-19)16-25-22(27)17-26(21-12-7-6-11-20(21)24)31(28,29)23-13-8-14-30-23/h3-14,18H,2,15-17H2,1H3,(H,25,27) |
| InChIKey | PBDISXDJAGMVRV-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.60 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |