C16H19FN2O3S2 — CID 30256313
N,N-diethyl-2-(2-fluoro-N-thiophen-2-ylsulfonylanilino)acetamide (PubChem CID 30256313) has the molecular formula C16H19FN2O3S2 and a molecular weight of 370.47 g/mol. Its IUPAC name is N,N-diethyl-2-(2-fluoro-N-thiophen-2-ylsulfonylanilino)acetamide.
| Compound Name | N,N-diethyl-2-(2-fluoro-N-thiophen-2-ylsulfonylanilino)acetamide |
|---|---|
| PubChem CID | 30256313 |
| Molecular Formula | C16H19FN2O3S2 |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | N,N-diethyl-2-(2-fluoro-N-thiophen-2-ylsulfonylanilino)acetamide |
| SMILES | CCN(CC)C(=O)CN(c1ccccc1F)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C16H19FN2O3S2/c1-3-18(4-2)15(20)12-19(14-9-6-5-8-13(14)17)24(21,22)16-10-7-11-23-16/h5-11H,3-4,12H2,1-2H3 |
| InChIKey | QIKXZLSRLCOTLV-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |