C18H20FN3O4S2 — CID 30267650
1-[2-(2-fluoro-N-thiophen-2-ylsulfonylanilino)acetyl]piperidine-4-carboxamide (PubChem CID 30267650) has the molecular formula C18H20FN3O4S2 and a molecular weight of 425.51 g/mol. Its IUPAC name is 1-[2-(2-fluoro-N-thiophen-2-ylsulfonylanilino)acetyl]piperidine-4-carboxamide.
| Compound Name | 1-[2-(2-fluoro-N-thiophen-2-ylsulfonylanilino)acetyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 30267650 |
| Molecular Formula | C18H20FN3O4S2 |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.09 |
| IUPAC Name | 1-[2-(2-fluoro-N-thiophen-2-ylsulfonylanilino)acetyl]piperidine-4-carboxamide |
| SMILES | NC(=O)C1CCN(C(=O)CN(c2ccccc2F)S(=O)(=O)c2cccs2)CC1 |
| InChI | InChI=1S/C18H20FN3O4S2/c19-14-4-1-2-5-15(14)22(28(25,26)17-6-3-11-27-17)12-16(23)21-9-7-13(8-10-21)18(20)24/h1-6,11,13H,7-10,12H2,(H2,20,24) |
| InChIKey | CFQRXOGGGNZDGX-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 100.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |