C14H15FN2O3S2 — CID 30255328
N-ethyl-2-(2-fluoro-N-thiophen-2-ylsulfonylanilino)acetamide (PubChem CID 30255328) has the molecular formula C14H15FN2O3S2 and a molecular weight of 342.42 g/mol. Its IUPAC name is N-ethyl-2-(2-fluoro-N-thiophen-2-ylsulfonylanilino)acetamide.
| Compound Name | N-ethyl-2-(2-fluoro-N-thiophen-2-ylsulfonylanilino)acetamide |
|---|---|
| PubChem CID | 30255328 |
| Molecular Formula | C14H15FN2O3S2 |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.05 |
| IUPAC Name | N-ethyl-2-(2-fluoro-N-thiophen-2-ylsulfonylanilino)acetamide |
| SMILES | CCNC(=O)CN(c1ccccc1F)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C14H15FN2O3S2/c1-2-16-13(18)10-17(12-7-4-3-6-11(12)15)22(19,20)14-8-5-9-21-14/h3-9H,2,10H2,1H3,(H,16,18) |
| InChIKey | QZBVJKDYTCYXOC-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |