C21H21FN2O3S3 — CID 30278173
2-(2-fluoro-N-thiophen-2-ylsulfonylanilino)-N-(3-phenylsulfanylpropyl)acetamide (PubChem CID 30278173) has the molecular formula C21H21FN2O3S3 and a molecular weight of 464.61 g/mol. Its IUPAC name is 2-(2-fluoro-N-thiophen-2-ylsulfonylanilino)-N-(3-phenylsulfanylpropyl)acetamide.
| Compound Name | 2-(2-fluoro-N-thiophen-2-ylsulfonylanilino)-N-(3-phenylsulfanylpropyl)acetamide |
|---|---|
| PubChem CID | 30278173 |
| Molecular Formula | C21H21FN2O3S3 |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.07 |
| IUPAC Name | 2-(2-fluoro-N-thiophen-2-ylsulfonylanilino)-N-(3-phenylsulfanylpropyl)acetamide |
| SMILES | O=C(CN(c1ccccc1F)S(=O)(=O)c1cccs1)NCCCSc1ccccc1 |
| InChI | InChI=1S/C21H21FN2O3S3/c22-18-10-4-5-11-19(18)24(30(26,27)21-12-6-14-29-21)16-20(25)23-13-7-15-28-17-8-2-1-3-9-17/h1-6,8-12,14H,7,13,15-16H2,(H,23,25) |
| InChIKey | NUZCOGQRNHLHQD-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|