C21H20ClFN2O3S3 — CID 30278205
N-[3-(4-chlorophenyl)sulfanylpropyl]-2-(4-fluoro-N-thiophen-2-ylsulfonylanilino)acetamide (PubChem CID 30278205) has the molecular formula C21H20ClFN2O3S3 and a molecular weight of 499.05 g/mol. Its IUPAC name is N-[3-(4-chlorophenyl)sulfanylpropyl]-2-(4-fluoro-N-thiophen-2-ylsulfonylanilino)acetamide.
| Compound Name | N-[3-(4-chlorophenyl)sulfanylpropyl]-2-(4-fluoro-N-thiophen-2-ylsulfonylanilino)acetamide |
|---|---|
| PubChem CID | 30278205 |
| Molecular Formula | C21H20ClFN2O3S3 |
| Molecular Weight | 499.05 g/mol |
| Exact Mass | 498.03 |
| IUPAC Name | N-[3-(4-chlorophenyl)sulfanylpropyl]-2-(4-fluoro-N-thiophen-2-ylsulfonylanilino)acetamide |
| SMILES | O=C(CN(c1ccc(F)cc1)S(=O)(=O)c1cccs1)NCCCSc1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H20ClFN2O3S3/c22-16-4-10-19(11-5-16)29-14-2-12-24-20(26)15-25(18-8-6-17(23)7-9-18)31(27,28)21-3-1-13-30-21/h1,3-11,13H,2,12,14-15H2,(H,24,26) |
| InChIKey | KDHZCIGQMYAQCI-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.05 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|