C16H19FN2O4S2 — CID 30257544
2-(4-fluoro-N-thiophen-2-ylsulfonylanilino)-N-(3-methoxypropyl)acetamide (PubChem CID 30257544) has the molecular formula C16H19FN2O4S2 and a molecular weight of 386.47 g/mol. Its IUPAC name is 2-(4-fluoro-N-thiophen-2-ylsulfonylanilino)-N-(3-methoxypropyl)acetamide.
| Compound Name | 2-(4-fluoro-N-thiophen-2-ylsulfonylanilino)-N-(3-methoxypropyl)acetamide |
|---|---|
| PubChem CID | 30257544 |
| Molecular Formula | C16H19FN2O4S2 |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | 2-(4-fluoro-N-thiophen-2-ylsulfonylanilino)-N-(3-methoxypropyl)acetamide |
| SMILES | COCCCNC(=O)CN(c1ccc(F)cc1)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C16H19FN2O4S2/c1-23-10-3-9-18-15(20)12-19(14-7-5-13(17)6-8-14)25(21,22)16-4-2-11-24-16/h2,4-8,11H,3,9-10,12H2,1H3,(H,18,20) |
| InChIKey | RWDPHODBNONIPV-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|