C21H21FN2O3S2 — CID 43900479
2-(4-fluoro-N-thiophen-2-ylsulfonylanilino)-N-(1-phenylpropyl)acetamide (PubChem CID 43900479) has the molecular formula C21H21FN2O3S2 and a molecular weight of 432.54 g/mol. Its IUPAC name is 2-(4-fluoro-N-thiophen-2-ylsulfonylanilino)-N-(1-phenylpropyl)acetamide.
| Compound Name | 2-(4-fluoro-N-thiophen-2-ylsulfonylanilino)-N-(1-phenylpropyl)acetamide |
|---|---|
| PubChem CID | 43900479 |
| Molecular Formula | C21H21FN2O3S2 |
| Molecular Weight | 432.54 g/mol |
| Exact Mass | 432.10 |
| IUPAC Name | 2-(4-fluoro-N-thiophen-2-ylsulfonylanilino)-N-(1-phenylpropyl)acetamide |
| SMILES | CCC(NC(=O)CN(c1ccc(F)cc1)S(=O)(=O)c1cccs1)c1ccccc1 |
| InChI | InChI=1S/C21H21FN2O3S2/c1-2-19(16-7-4-3-5-8-16)23-20(25)15-24(18-12-10-17(22)11-13-18)29(26,27)21-9-6-14-28-21/h3-14,19H,2,15H2,1H3,(H,23,25) |
| InChIKey | CICQLXRQROZKSX-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.54 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |