C21H21FN2O5S3 — CID 43901770
2-(4-fluoro-N-thiophen-2-ylsulfonylanilino)-N-[1-(4-methylsulfonylphenyl)ethyl]acetamide (PubChem CID 43901770) has the molecular formula C21H21FN2O5S3 and a molecular weight of 496.61 g/mol. Its IUPAC name is 2-(4-fluoro-N-thiophen-2-ylsulfonylanilino)-N-[1-(4-methylsulfonylphenyl)ethyl]acetamide.
| Compound Name | 2-(4-fluoro-N-thiophen-2-ylsulfonylanilino)-N-[1-(4-methylsulfonylphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 43901770 |
| Molecular Formula | C21H21FN2O5S3 |
| Molecular Weight | 496.61 g/mol |
| Exact Mass | 496.06 |
| IUPAC Name | 2-(4-fluoro-N-thiophen-2-ylsulfonylanilino)-N-[1-(4-methylsulfonylphenyl)ethyl]acetamide |
| SMILES | CC(NC(=O)CN(c1ccc(F)cc1)S(=O)(=O)c1cccs1)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C21H21FN2O5S3/c1-15(16-5-11-19(12-6-16)31(2,26)27)23-20(25)14-24(18-9-7-17(22)8-10-18)32(28,29)21-4-3-13-30-21/h3-13,15H,14H2,1-2H3,(H,23,25) |
| InChIKey | GNTBZOMUNCAQKX-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.61 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |