C17H21FN2O4S2 — CID 30268780
N-(3-ethoxypropyl)-2-(4-fluoro-N-thiophen-2-ylsulfonylanilino)acetamide (PubChem CID 30268780) has the molecular formula C17H21FN2O4S2 and a molecular weight of 400.50 g/mol. Its IUPAC name is N-(3-ethoxypropyl)-2-(4-fluoro-N-thiophen-2-ylsulfonylanilino)acetamide.
| Compound Name | N-(3-ethoxypropyl)-2-(4-fluoro-N-thiophen-2-ylsulfonylanilino)acetamide |
|---|---|
| PubChem CID | 30268780 |
| Molecular Formula | C17H21FN2O4S2 |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.09 |
| IUPAC Name | N-(3-ethoxypropyl)-2-(4-fluoro-N-thiophen-2-ylsulfonylanilino)acetamide |
| SMILES | CCOCCCNC(=O)CN(c1ccc(F)cc1)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C17H21FN2O4S2/c1-2-24-11-4-10-19-16(21)13-20(15-8-6-14(18)7-9-15)26(22,23)17-5-3-12-25-17/h3,5-9,12H,2,4,10-11,13H2,1H3,(H,19,21) |
| InChIKey | UYEIQOJVWJRGAB-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|