C21H20F2N2O3S3 — CID 30272234
N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]-2-(4-fluoro-N-thiophen-2-ylsulfonylanilino)acetamide (PubChem CID 30272234) has the molecular formula C21H20F2N2O3S3 and a molecular weight of 482.60 g/mol. Its IUPAC name is N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]-2-(4-fluoro-N-thiophen-2-ylsulfonylanilino)acetamide.
| Compound Name | N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]-2-(4-fluoro-N-thiophen-2-ylsulfonylanilino)acetamide |
|---|---|
| PubChem CID | 30272234 |
| Molecular Formula | C21H20F2N2O3S3 |
| Molecular Weight | 482.60 g/mol |
| Exact Mass | 482.06 |
| IUPAC Name | N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]-2-(4-fluoro-N-thiophen-2-ylsulfonylanilino)acetamide |
| SMILES | O=C(CN(c1ccc(F)cc1)S(=O)(=O)c1cccs1)NCCSCc1ccccc1F |
| InChI | InChI=1S/C21H20F2N2O3S3/c22-17-7-9-18(10-8-17)25(31(27,28)21-6-3-12-30-21)14-20(26)24-11-13-29-15-16-4-1-2-5-19(16)23/h1-10,12H,11,13-15H2,(H,24,26) |
| InChIKey | ULFZVXMWTSKACT-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.60 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|