C23H21F3N2O3S2 — CID 30272225
2-(4-fluoro-N-(4-fluorophenyl)sulfonylanilino)-N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]acetamide (PubChem CID 30272225) has the molecular formula C23H21F3N2O3S2 and a molecular weight of 494.56 g/mol. Its IUPAC name is 2-(4-fluoro-N-(4-fluorophenyl)sulfonylanilino)-N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]acetamide.
| Compound Name | 2-(4-fluoro-N-(4-fluorophenyl)sulfonylanilino)-N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]acetamide |
|---|---|
| PubChem CID | 30272225 |
| Molecular Formula | C23H21F3N2O3S2 |
| Molecular Weight | 494.56 g/mol |
| Exact Mass | 494.09 |
| IUPAC Name | 2-(4-fluoro-N-(4-fluorophenyl)sulfonylanilino)-N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]acetamide |
| SMILES | O=C(CN(c1ccc(F)cc1)S(=O)(=O)c1ccc(F)cc1)NCCSCc1ccccc1F |
| InChI | InChI=1S/C23H21F3N2O3S2/c24-18-5-9-20(10-6-18)28(33(30,31)21-11-7-19(25)8-12-21)15-23(29)27-13-14-32-16-17-3-1-2-4-22(17)26/h1-12H,13-16H2,(H,27,29) |
| InChIKey | BYNKPGLTSHBCAZ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.56 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|