C23H20Cl2F2N2O3S2 — CID 43899710
N-[2-[(3,4-dichlorophenyl)methylsulfanyl]ethyl]-2-(4-fluoro-N-(4-fluorophenyl)sulfonylanilino)acetamide (PubChem CID 43899710) has the molecular formula C23H20Cl2F2N2O3S2 and a molecular weight of 545.46 g/mol. Its IUPAC name is N-[2-[(3,4-dichlorophenyl)methylsulfanyl]ethyl]-2-(4-fluoro-N-(4-fluorophenyl)sulfonylanilino)acetamide.
| Compound Name | N-[2-[(3,4-dichlorophenyl)methylsulfanyl]ethyl]-2-(4-fluoro-N-(4-fluorophenyl)sulfonylanilino)acetamide |
|---|---|
| PubChem CID | 43899710 |
| Molecular Formula | C23H20Cl2F2N2O3S2 |
| Molecular Weight | 545.46 g/mol |
| Exact Mass | 544.03 |
| IUPAC Name | N-[2-[(3,4-dichlorophenyl)methylsulfanyl]ethyl]-2-(4-fluoro-N-(4-fluorophenyl)sulfonylanilino)acetamide |
| SMILES | O=C(CN(c1ccc(F)cc1)S(=O)(=O)c1ccc(F)cc1)NCCSCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C23H20Cl2F2N2O3S2/c24-21-10-1-16(13-22(21)25)15-33-12-11-28-23(30)14-29(19-6-2-17(26)3-7-19)34(31,32)20-8-4-18(27)5-9-20/h1-10,13H,11-12,14-15H2,(H,28,30) |
| InChIKey | IZIDRNOSQLNWJX-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.46 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|