C24H23ClF2N2O3S2 — CID 43899247
2-[N-(benzenesulfonyl)-3-chloro-4-fluoroanilino]-N-[3-[(4-fluorophenyl)methylsulfanyl]propyl]acetamide (PubChem CID 43899247) has the molecular formula C24H23ClF2N2O3S2 and a molecular weight of 525.04 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-3-chloro-4-fluoroanilino]-N-[3-[(4-fluorophenyl)methylsulfanyl]propyl]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-3-chloro-4-fluoroanilino]-N-[3-[(4-fluorophenyl)methylsulfanyl]propyl]acetamide |
|---|---|
| PubChem CID | 43899247 |
| Molecular Formula | C24H23ClF2N2O3S2 |
| Molecular Weight | 525.04 g/mol |
| Exact Mass | 524.08 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-3-chloro-4-fluoroanilino]-N-[3-[(4-fluorophenyl)methylsulfanyl]propyl]acetamide |
| SMILES | O=C(CN(c1ccc(F)c(Cl)c1)S(=O)(=O)c1ccccc1)NCCCSCc1ccc(F)cc1 |
| InChI | InChI=1S/C24H23ClF2N2O3S2/c25-22-15-20(11-12-23(22)27)29(34(31,32)21-5-2-1-3-6-21)16-24(30)28-13-4-14-33-17-18-7-9-19(26)10-8-18/h1-3,5-12,15H,4,13-14,16-17H2,(H,28,30) |
| InChIKey | VLKIWSWQZRRZMI-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.04 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|