C25H23Cl2F3N2O3S2 — CID 43893559
2-[N-(benzenesulfonyl)-2-chloro-5-(trifluoromethyl)anilino]-N-[3-[(4-chlorophenyl)methylsulfanyl]propyl]acetamide (PubChem CID 43893559) has the molecular formula C25H23Cl2F3N2O3S2 and a molecular weight of 591.50 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-2-chloro-5-(trifluoromethyl)anilino]-N-[3-[(4-chlorophenyl)methylsulfanyl]propyl]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-2-chloro-5-(trifluoromethyl)anilino]-N-[3-[(4-chlorophenyl)methylsulfanyl]propyl]acetamide |
|---|---|
| PubChem CID | 43893559 |
| Molecular Formula | C25H23Cl2F3N2O3S2 |
| Molecular Weight | 591.50 g/mol |
| Exact Mass | 590.05 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-2-chloro-5-(trifluoromethyl)anilino]-N-[3-[(4-chlorophenyl)methylsulfanyl]propyl]acetamide |
| SMILES | O=C(CN(c1cc(C(F)(F)F)ccc1Cl)S(=O)(=O)c1ccccc1)NCCCSCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H23Cl2F3N2O3S2/c26-20-10-7-18(8-11-20)17-36-14-4-13-31-24(33)16-32(37(34,35)21-5-2-1-3-6-21)23-15-19(25(28,29)30)9-12-22(23)27/h1-3,5-12,15H,4,13-14,16-17H2,(H,31,33) |
| InChIKey | RMWCNVYTSNTHKN-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.50 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|