C24H24Cl2N2O3S2 — CID 30205045
2-[N-(benzenesulfonyl)-3,5-dichloroanilino]-N-(3-benzylsulfanylpropyl)acetamide (PubChem CID 30205045) has the molecular formula C24H24Cl2N2O3S2 and a molecular weight of 523.51 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-3,5-dichloroanilino]-N-(3-benzylsulfanylpropyl)acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-3,5-dichloroanilino]-N-(3-benzylsulfanylpropyl)acetamide |
|---|---|
| PubChem CID | 30205045 |
| Molecular Formula | C24H24Cl2N2O3S2 |
| Molecular Weight | 523.51 g/mol |
| Exact Mass | 522.06 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-3,5-dichloroanilino]-N-(3-benzylsulfanylpropyl)acetamide |
| SMILES | O=C(CN(c1cc(Cl)cc(Cl)c1)S(=O)(=O)c1ccccc1)NCCCSCc1ccccc1 |
| InChI | InChI=1S/C24H24Cl2N2O3S2/c25-20-14-21(26)16-22(15-20)28(33(30,31)23-10-5-2-6-11-23)17-24(29)27-12-7-13-32-18-19-8-3-1-4-9-19/h1-6,8-11,14-16H,7,12-13,17-18H2,(H,27,29) |
| InChIKey | FOXYLKMBYLMTBA-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.51 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|