C26H30N2O3S2 — CID 30175211
2-[N-(benzenesulfonyl)-4-methylanilino]-N-[3-[(4-methylphenyl)methylsulfanyl]propyl]acetamide (PubChem CID 30175211) has the molecular formula C26H30N2O3S2 and a molecular weight of 482.67 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-4-methylanilino]-N-[3-[(4-methylphenyl)methylsulfanyl]propyl]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-4-methylanilino]-N-[3-[(4-methylphenyl)methylsulfanyl]propyl]acetamide |
|---|---|
| PubChem CID | 30175211 |
| Molecular Formula | C26H30N2O3S2 |
| Molecular Weight | 482.67 g/mol |
| Exact Mass | 482.17 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-4-methylanilino]-N-[3-[(4-methylphenyl)methylsulfanyl]propyl]acetamide |
| SMILES | Cc1ccc(CSCCCNC(=O)CN(c2ccc(C)cc2)S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C26H30N2O3S2/c1-21-9-13-23(14-10-21)20-32-18-6-17-27-26(29)19-28(24-15-11-22(2)12-16-24)33(30,31)25-7-4-3-5-8-25/h3-5,7-16H,6,17-20H2,1-2H3,(H,27,29) |
| InChIKey | KKKNOLCBYMUBGK-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.67 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|