C27H32N2O3S2 — CID 30229583
2-[N-(benzenesulfonyl)-4-ethylanilino]-N-[3-[(4-methylphenyl)methylsulfanyl]propyl]acetamide (PubChem CID 30229583) has the molecular formula C27H32N2O3S2 and a molecular weight of 496.70 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-4-ethylanilino]-N-[3-[(4-methylphenyl)methylsulfanyl]propyl]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-4-ethylanilino]-N-[3-[(4-methylphenyl)methylsulfanyl]propyl]acetamide |
|---|---|
| PubChem CID | 30229583 |
| Molecular Formula | C27H32N2O3S2 |
| Molecular Weight | 496.70 g/mol |
| Exact Mass | 496.19 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-4-ethylanilino]-N-[3-[(4-methylphenyl)methylsulfanyl]propyl]acetamide |
| SMILES | CCc1ccc(N(CC(=O)NCCCSCc2ccc(C)cc2)S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C27H32N2O3S2/c1-3-23-14-16-25(17-15-23)29(34(31,32)26-8-5-4-6-9-26)20-27(30)28-18-7-19-33-21-24-12-10-22(2)11-13-24/h4-6,8-17H,3,7,18-21H2,1-2H3,(H,28,30) |
| InChIKey | OXHHRBIFZRPMEX-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.70 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|