C24H24FIN2O3S2 — CID 43897828
2-[N-(benzenesulfonyl)-4-iodoanilino]-N-[3-[(4-fluorophenyl)methylsulfanyl]propyl]acetamide (PubChem CID 43897828) has the molecular formula C24H24FIN2O3S2 and a molecular weight of 598.50 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-4-iodoanilino]-N-[3-[(4-fluorophenyl)methylsulfanyl]propyl]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-4-iodoanilino]-N-[3-[(4-fluorophenyl)methylsulfanyl]propyl]acetamide |
|---|---|
| PubChem CID | 43897828 |
| Molecular Formula | C24H24FIN2O3S2 |
| Molecular Weight | 598.50 g/mol |
| Exact Mass | 598.03 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-4-iodoanilino]-N-[3-[(4-fluorophenyl)methylsulfanyl]propyl]acetamide |
| SMILES | O=C(CN(c1ccc(I)cc1)S(=O)(=O)c1ccccc1)NCCCSCc1ccc(F)cc1 |
| InChI | InChI=1S/C24H24FIN2O3S2/c25-20-9-7-19(8-10-20)18-32-16-4-15-27-24(29)17-28(22-13-11-21(26)12-14-22)33(30,31)23-5-2-1-3-6-23/h1-3,5-14H,4,15-18H2,(H,27,29) |
| InChIKey | IPKUWFAMWKBABC-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.50 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|