C26H28F2N2O5S2 — CID 43898160
2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-fluoroanilino)-N-[3-[(4-fluorophenyl)methylsulfanyl]propyl]acetamide (PubChem CID 43898160) has the molecular formula C26H28F2N2O5S2 and a molecular weight of 550.65 g/mol. Its IUPAC name is 2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-fluoroanilino)-N-[3-[(4-fluorophenyl)methylsulfanyl]propyl]acetamide.
| Compound Name | 2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-fluoroanilino)-N-[3-[(4-fluorophenyl)methylsulfanyl]propyl]acetamide |
|---|---|
| PubChem CID | 43898160 |
| Molecular Formula | C26H28F2N2O5S2 |
| Molecular Weight | 550.65 g/mol |
| Exact Mass | 550.14 |
| IUPAC Name | 2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-fluoroanilino)-N-[3-[(4-fluorophenyl)methylsulfanyl]propyl]acetamide |
| SMILES | COc1ccc(S(=O)(=O)N(CC(=O)NCCCSCc2ccc(F)cc2)c2ccc(F)cc2)cc1OC |
| InChI | InChI=1S/C26H28F2N2O5S2/c1-34-24-13-12-23(16-25(24)35-2)37(32,33)30(22-10-8-21(28)9-11-22)17-26(31)29-14-3-15-36-18-19-4-6-20(27)7-5-19/h4-13,16H,3,14-15,17-18H2,1-2H3,(H,29,31) |
| InChIKey | JXWLHNCYMJPLDS-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.65 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|