C26H28F2N2O4S2 — CID 43898977
2-(N-(4-ethoxyphenyl)sulfonyl-4-fluoroanilino)-N-[3-[(4-fluorophenyl)methylsulfanyl]propyl]acetamide (PubChem CID 43898977) has the molecular formula C26H28F2N2O4S2 and a molecular weight of 534.65 g/mol. Its IUPAC name is 2-(N-(4-ethoxyphenyl)sulfonyl-4-fluoroanilino)-N-[3-[(4-fluorophenyl)methylsulfanyl]propyl]acetamide.
| Compound Name | 2-(N-(4-ethoxyphenyl)sulfonyl-4-fluoroanilino)-N-[3-[(4-fluorophenyl)methylsulfanyl]propyl]acetamide |
|---|---|
| PubChem CID | 43898977 |
| Molecular Formula | C26H28F2N2O4S2 |
| Molecular Weight | 534.65 g/mol |
| Exact Mass | 534.15 |
| IUPAC Name | 2-(N-(4-ethoxyphenyl)sulfonyl-4-fluoroanilino)-N-[3-[(4-fluorophenyl)methylsulfanyl]propyl]acetamide |
| SMILES | CCOc1ccc(S(=O)(=O)N(CC(=O)NCCCSCc2ccc(F)cc2)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C26H28F2N2O4S2/c1-2-34-24-12-14-25(15-13-24)36(32,33)30(23-10-8-22(28)9-11-23)18-26(31)29-16-3-17-35-19-20-4-6-21(27)7-5-20/h4-15H,2-3,16-19H2,1H3,(H,29,31) |
| InChIKey | DBSYODBBIRWWSR-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.65 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|