C29H36N2O6S2 — CID 43897443
2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-ethoxyanilino)-N-[3-[(4-methylphenyl)methylsulfanyl]propyl]acetamide (PubChem CID 43897443) has the molecular formula C29H36N2O6S2 and a molecular weight of 572.75 g/mol. Its IUPAC name is 2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-ethoxyanilino)-N-[3-[(4-methylphenyl)methylsulfanyl]propyl]acetamide.
| Compound Name | 2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-ethoxyanilino)-N-[3-[(4-methylphenyl)methylsulfanyl]propyl]acetamide |
|---|---|
| PubChem CID | 43897443 |
| Molecular Formula | C29H36N2O6S2 |
| Molecular Weight | 572.75 g/mol |
| Exact Mass | 572.20 |
| IUPAC Name | 2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-ethoxyanilino)-N-[3-[(4-methylphenyl)methylsulfanyl]propyl]acetamide |
| SMILES | CCOc1ccc(N(CC(=O)NCCCSCc2ccc(C)cc2)S(=O)(=O)c2ccc(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C29H36N2O6S2/c1-5-37-25-13-11-24(12-14-25)31(39(33,34)26-15-16-27(35-3)28(19-26)36-4)20-29(32)30-17-6-18-38-21-23-9-7-22(2)8-10-23/h7-16,19H,5-6,17-18,20-21H2,1-4H3,(H,30,32) |
| InChIKey | VMVPJRAGSHSQPS-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.75 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|