C27H31FN2O5S2 — CID 43898155
2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-fluoroanilino)-N-[3-[(4-methylphenyl)methylsulfanyl]propyl]acetamide (PubChem CID 43898155) has the molecular formula C27H31FN2O5S2 and a molecular weight of 546.69 g/mol. Its IUPAC name is 2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-fluoroanilino)-N-[3-[(4-methylphenyl)methylsulfanyl]propyl]acetamide.
| Compound Name | 2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-fluoroanilino)-N-[3-[(4-methylphenyl)methylsulfanyl]propyl]acetamide |
|---|---|
| PubChem CID | 43898155 |
| Molecular Formula | C27H31FN2O5S2 |
| Molecular Weight | 546.69 g/mol |
| Exact Mass | 546.17 |
| IUPAC Name | 2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-fluoroanilino)-N-[3-[(4-methylphenyl)methylsulfanyl]propyl]acetamide |
| SMILES | COc1ccc(S(=O)(=O)N(CC(=O)NCCCSCc2ccc(C)cc2)c2ccc(F)cc2)cc1OC |
| InChI | InChI=1S/C27H31FN2O5S2/c1-20-5-7-21(8-6-20)19-36-16-4-15-29-27(31)18-30(23-11-9-22(28)10-12-23)37(32,33)24-13-14-25(34-2)26(17-24)35-3/h5-14,17H,4,15-16,18-19H2,1-3H3,(H,29,31) |
| InChIKey | FGZQECBVQDYUBG-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.69 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|