C26H29FN2O5S — CID 30227497
N-[3-(3,4-dimethoxyphenyl)propyl]-2-(N-(4-fluorophenyl)sulfonyl-4-methylanilino)acetamide (PubChem CID 30227497) has the molecular formula C26H29FN2O5S and a molecular weight of 500.59 g/mol. Its IUPAC name is N-[3-(3,4-dimethoxyphenyl)propyl]-2-(N-(4-fluorophenyl)sulfonyl-4-methylanilino)acetamide.
| Compound Name | N-[3-(3,4-dimethoxyphenyl)propyl]-2-(N-(4-fluorophenyl)sulfonyl-4-methylanilino)acetamide |
|---|---|
| PubChem CID | 30227497 |
| Molecular Formula | C26H29FN2O5S |
| Molecular Weight | 500.59 g/mol |
| Exact Mass | 500.18 |
| IUPAC Name | N-[3-(3,4-dimethoxyphenyl)propyl]-2-(N-(4-fluorophenyl)sulfonyl-4-methylanilino)acetamide |
| SMILES | COc1ccc(CCCNC(=O)CN(c2ccc(C)cc2)S(=O)(=O)c2ccc(F)cc2)cc1OC |
| InChI | InChI=1S/C26H29FN2O5S/c1-19-6-11-22(12-7-19)29(35(31,32)23-13-9-21(27)10-14-23)18-26(30)28-16-4-5-20-8-15-24(33-2)25(17-20)34-3/h6-15,17H,4-5,16,18H2,1-3H3,(H,28,30) |
| InChIKey | NPSYLZUDCMDTNL-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.59 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|