C25H26F2N2O5S — CID 30244396
2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-fluoroanilino)-N-[3-(4-fluorophenyl)propyl]acetamide (PubChem CID 30244396) has the molecular formula C25H26F2N2O5S and a molecular weight of 504.56 g/mol. Its IUPAC name is 2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-fluoroanilino)-N-[3-(4-fluorophenyl)propyl]acetamide.
| Compound Name | 2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-fluoroanilino)-N-[3-(4-fluorophenyl)propyl]acetamide |
|---|---|
| PubChem CID | 30244396 |
| Molecular Formula | C25H26F2N2O5S |
| Molecular Weight | 504.56 g/mol |
| Exact Mass | 504.15 |
| IUPAC Name | 2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-fluoroanilino)-N-[3-(4-fluorophenyl)propyl]acetamide |
| SMILES | COc1ccc(S(=O)(=O)N(CC(=O)NCCCc2ccc(F)cc2)c2ccc(F)cc2)cc1OC |
| InChI | InChI=1S/C25H26F2N2O5S/c1-33-23-14-13-22(16-24(23)34-2)35(31,32)29(21-11-9-20(27)10-12-21)17-25(30)28-15-3-4-18-5-7-19(26)8-6-18/h5-14,16H,3-4,15,17H2,1-2H3,(H,28,30) |
| InChIKey | ZDUZAFDWGJHJAF-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.56 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|