C24H31FN2O6S — CID 30244473
N-(3-cyclopentyloxypropyl)-2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-fluoroanilino)acetamide (PubChem CID 30244473) has the molecular formula C24H31FN2O6S and a molecular weight of 494.59 g/mol. Its IUPAC name is N-(3-cyclopentyloxypropyl)-2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-fluoroanilino)acetamide.
| Compound Name | N-(3-cyclopentyloxypropyl)-2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-fluoroanilino)acetamide |
|---|---|
| PubChem CID | 30244473 |
| Molecular Formula | C24H31FN2O6S |
| Molecular Weight | 494.59 g/mol |
| Exact Mass | 494.19 |
| IUPAC Name | N-(3-cyclopentyloxypropyl)-2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-fluoroanilino)acetamide |
| SMILES | COc1ccc(S(=O)(=O)N(CC(=O)NCCCOC2CCCC2)c2ccc(F)cc2)cc1OC |
| InChI | InChI=1S/C24H31FN2O6S/c1-31-22-13-12-21(16-23(22)32-2)34(29,30)27(19-10-8-18(25)9-11-19)17-24(28)26-14-5-15-33-20-6-3-4-7-20/h8-13,16,20H,3-7,14-15,17H2,1-2H3,(H,26,28) |
| InChIKey | VYFJJXUTQYFDTF-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.59 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|