C27H38N2O8S — CID 43898282
N-(3-cyclohexyloxypropyl)-2-(N-(3,4-dimethoxyphenyl)sulfonyl-2,5-dimethoxyanilino)acetamide (PubChem CID 43898282) has the molecular formula C27H38N2O8S and a molecular weight of 550.67 g/mol. Its IUPAC name is N-(3-cyclohexyloxypropyl)-2-(N-(3,4-dimethoxyphenyl)sulfonyl-2,5-dimethoxyanilino)acetamide.
| Compound Name | N-(3-cyclohexyloxypropyl)-2-(N-(3,4-dimethoxyphenyl)sulfonyl-2,5-dimethoxyanilino)acetamide |
|---|---|
| PubChem CID | 43898282 |
| Molecular Formula | C27H38N2O8S |
| Molecular Weight | 550.67 g/mol |
| Exact Mass | 550.23 |
| IUPAC Name | N-(3-cyclohexyloxypropyl)-2-(N-(3,4-dimethoxyphenyl)sulfonyl-2,5-dimethoxyanilino)acetamide |
| SMILES | COc1ccc(OC)c(N(CC(=O)NCCCOC2CCCCC2)S(=O)(=O)c2ccc(OC)c(OC)c2)c1 |
| InChI | InChI=1S/C27H38N2O8S/c1-33-21-11-13-24(34-2)23(17-21)29(38(31,32)22-12-14-25(35-3)26(18-22)36-4)19-27(30)28-15-8-16-37-20-9-6-5-7-10-20/h11-14,17-18,20H,5-10,15-16,19H2,1-4H3,(H,28,30) |
| InChIKey | IPASANANEJCDEP-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 112.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.67 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|