C27H38N2O5S2 — CID 30227715
N-(3-cyclohexylsulfanylpropyl)-2-(N-(3,4-dimethoxyphenyl)sulfonyl-3,5-dimethylanilino)acetamide (PubChem CID 30227715) has the molecular formula C27H38N2O5S2 and a molecular weight of 534.74 g/mol. Its IUPAC name is N-(3-cyclohexylsulfanylpropyl)-2-(N-(3,4-dimethoxyphenyl)sulfonyl-3,5-dimethylanilino)acetamide.
| Compound Name | N-(3-cyclohexylsulfanylpropyl)-2-(N-(3,4-dimethoxyphenyl)sulfonyl-3,5-dimethylanilino)acetamide |
|---|---|
| PubChem CID | 30227715 |
| Molecular Formula | C27H38N2O5S2 |
| Molecular Weight | 534.74 g/mol |
| Exact Mass | 534.22 |
| IUPAC Name | N-(3-cyclohexylsulfanylpropyl)-2-(N-(3,4-dimethoxyphenyl)sulfonyl-3,5-dimethylanilino)acetamide |
| SMILES | COc1ccc(S(=O)(=O)N(CC(=O)NCCCSC2CCCCC2)c2cc(C)cc(C)c2)cc1OC |
| InChI | InChI=1S/C27H38N2O5S2/c1-20-15-21(2)17-22(16-20)29(36(31,32)24-11-12-25(33-3)26(18-24)34-4)19-27(30)28-13-8-14-35-23-9-6-5-7-10-23/h11-12,15-18,23H,5-10,13-14,19H2,1-4H3,(H,28,30) |
| InChIKey | HNHZMDJQZKHESA-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.74 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|