C25H33N3O5S — CID 1249641
N-(cycloheptylideneamino)-2-(N-(3,4-dimethoxyphenyl)sulfonyl-3,5-dimethylanilino)acetamide (PubChem CID 1249641) has the molecular formula C25H33N3O5S and a molecular weight of 487.62 g/mol. Its IUPAC name is N-(cycloheptylideneamino)-2-(N-(3,4-dimethoxyphenyl)sulfonyl-3,5-dimethylanilino)acetamide.
| Compound Name | N-(cycloheptylideneamino)-2-(N-(3,4-dimethoxyphenyl)sulfonyl-3,5-dimethylanilino)acetamide |
|---|---|
| PubChem CID | 1249641 |
| Molecular Formula | C25H33N3O5S |
| Molecular Weight | 487.62 g/mol |
| Exact Mass | 487.21 |
| IUPAC Name | N-(cycloheptylideneamino)-2-(N-(3,4-dimethoxyphenyl)sulfonyl-3,5-dimethylanilino)acetamide |
| SMILES | COc1ccc(S(=O)(=O)N(CC(=O)NN=C2CCCCCC2)c2cc(C)cc(C)c2)cc1OC |
| InChI | InChI=1S/C25H33N3O5S/c1-18-13-19(2)15-21(14-18)28(17-25(29)27-26-20-9-7-5-6-8-10-20)34(30,31)22-11-12-23(32-3)24(16-22)33-4/h11-16H,5-10,17H2,1-4H3,(H,27,29) |
| InChIKey | WFFVMJILVNBGIF-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.62 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|