C29H34N4O5S — CID 126353417
N-[(1-benzylpiperidin-4-ylidene)amino]-2-(3,4-dimethoxy-N-(4-methylphenyl)sulfonylanilino)acetamide (PubChem CID 126353417) has the molecular formula C29H34N4O5S and a molecular weight of 550.68 g/mol. Its IUPAC name is N-[(1-benzylpiperidin-4-ylidene)amino]-2-(3,4-dimethoxy-N-(4-methylphenyl)sulfonylanilino)acetamide.
| Compound Name | N-[(1-benzylpiperidin-4-ylidene)amino]-2-(3,4-dimethoxy-N-(4-methylphenyl)sulfonylanilino)acetamide |
|---|---|
| PubChem CID | 126353417 |
| Molecular Formula | C29H34N4O5S |
| Molecular Weight | 550.68 g/mol |
| Exact Mass | 550.22 |
| IUPAC Name | N-[(1-benzylpiperidin-4-ylidene)amino]-2-(3,4-dimethoxy-N-(4-methylphenyl)sulfonylanilino)acetamide |
| SMILES | COc1ccc(N(CC(=O)NN=C2CCN(Cc3ccccc3)CC2)S(=O)(=O)c2ccc(C)cc2)cc1OC |
| InChI | InChI=1S/C29H34N4O5S/c1-22-9-12-26(13-10-22)39(35,36)33(25-11-14-27(37-2)28(19-25)38-3)21-29(34)31-30-24-15-17-32(18-16-24)20-23-7-5-4-6-8-23/h4-14,19H,15-18,20-21H2,1-3H3,(H,31,34) |
| InChIKey | QILIUUCJGXXTGK-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.68 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|